CymitQuimica logo

CAS 847446-85-9

:

Benzaldehyde,4-[3-(trifluoromethyl)-2-pyridinyl]-

Description:
Benzaldehyde, 4-[3-(trifluoromethyl)-2-pyridinyl]- is an organic compound characterized by its structure, which features a benzaldehyde moiety substituted with a pyridine ring that contains a trifluoromethyl group. This compound typically exhibits a pale yellow to colorless liquid form and has a distinctive aromatic odor. It is known for its role in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. Additionally, the compound may exhibit moderate to high stability under standard conditions, but it should be handled with care due to potential toxicity and environmental impact. Its solubility characteristics often allow it to dissolve in organic solvents, while its reactivity can be attributed to the electrophilic nature of the carbonyl group in the benzaldehyde structure. Overall, this compound is significant in various chemical applications, particularly in the development of new materials and therapeutic agents.
Formula:C13H8F3NO
InChI:InChI=1S/C13H8F3NO/c14-13(15,16)11-2-1-7-17-12(11)10-5-3-9(8-18)4-6-10/h1-8H
InChI key:NBWILOUASOAOPH-UHFFFAOYSA-N
SMILES:C1=CC(=C(N=C1)C2=CC=C(C=C2)C=O)C(F)(F)F
Synonyms:
  • 4-(3-(Trifluoromethyl)pyridin-2-yl)benzaldehyde
  • 4-(5-Methylpyridin-2-yl)benzaldehyde
  • 4-(6-Methylpyridin-2-yl)benzaldehyde
Found 3 products.