CAS 84745-95-9
:Eriocalyxin B
Description:
Eriocalyxin B is a natural compound classified as a sesquiterpene lactone, primarily derived from the plant Eriophyllum confertiflorum, commonly known as the California goldenbush. This compound is notable for its complex structure, which includes a bicyclic framework and various functional groups that contribute to its biological activity. Eriocalyxin B exhibits a range of pharmacological properties, including anti-inflammatory, anticancer, and antimicrobial activities, making it a subject of interest in medicinal chemistry and pharmacology. Its mechanism of action often involves the modulation of signaling pathways, particularly those related to apoptosis and cell proliferation. Additionally, Eriocalyxin B has been studied for its potential to enhance the efficacy of certain chemotherapeutic agents. Due to its natural origin, it is also of interest in the field of natural product chemistry, where researchers explore its synthesis and potential applications in drug development. Overall, Eriocalyxin B represents a promising lead compound for further investigation in therapeutic contexts.
Formula:C20H24O5
InChI:InChI=1S/C20H24O5/c1-10-11-4-5-12-18-9-25-20(24,19(12,8-11)15(10)22)16(23)14(18)17(2,3)7-6-13(18)21/h6-7,11-12,14,16,23-24H,1,4-5,8-9H2,2-3H3/t11-,12+,14-,16?,18-,19+,20-/m1/s1
InChI key:InChIKey=RTIKCEKESDRWAE-ICNZGUNHSA-N
SMILES:O[C@]12[C@]34[C@]([C@]5([C@]([C@@H]1O)([C@@](C)(C)C=CC5=O)[H])CO2)(CC[C@](C3)(C(=C)C4=O)[H])[H]
Synonyms:- Kaura-2,16-diene-1,15-dione, 7,20-epoxy-6,7-dihydroxy-, (6β,7α)-
- (6β,7α)-7,20-Epoxy-6,7-dihydroxykaura-2,16-diene-1,15-dione
- Rabdosianone
- 6,11b-(Epoxymethano)-6a,9-methano-1H-cyclohepta[a]naphthalene, kaura-2,16-diene-1,15-dione deriv.
- Eriocalyxin B
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Eriocalyxin B
CAS:Eriocalyxin B triggers apoptosis in pancreatic cancer via caspase, p53, and STAT3 inhibition.Formula:C20H24O5Purity:99.84%Color and Shape:SolidMolecular weight:344.4Ref: TM-TN1620
1mg281.00€5mg620.00€1mL*10mM (DMSO)662.00€10mg875.00€25mg1,288.00€50mg1,738.00€100mg2,367.00€Eriocalyxin B
CAS:Eriocalyxin B is a natural diterpenoid compound, which is extracted from the plant Isodon eriocalyx, a member of the Lamiaceae family. It exhibits significant pharmacological activities, particularly in oncology research. The mode of action of Eriocalyxin B involves the inhibition of various signaling pathways critical for cancer cell proliferation, survival, and metastasis. Specifically, it targets NF-κB, a transcription factor known to regulate genes involved in inflammation and cell survival, as well as other pathways such as STAT3 and HIF-1α.
Formula:C20H24O5Purity:Min. 95%Molecular weight:344.4 g/mol




