CAS 847551-00-2

1H-Pyrazolo[3,4-d]pyrimidin-4-amine,3-iodo-1-(2-C-methyl-beta-D-ribofuranosyl)-

Description:

1H-Pyrazolo[3,4-d]pyrimidin-4-amine, 3-iodo-1-(2-C-methyl-beta-D-ribofuranosyl)- is a chemical compound characterized by its complex structure, which includes a pyrazolo-pyrimidine core and a ribofuranosyl moiety. This compound features a pyrazolo[3,4-d]pyrimidine framework, which is known for its biological activity, particularly in the field of medicinal chemistry. The presence of the iodine atom at the 3-position enhances its potential for biological interactions and may influence its pharmacokinetic properties. The C-methyl-beta-D-ribofuranosyl group suggests that this compound may exhibit nucleoside-like properties, potentially impacting its role in biological systems, such as antiviral or anticancer activities. Its unique structure may allow for specific interactions with biological targets, making it a candidate for further research in drug development. As with many compounds in this class, understanding its solubility, stability, and reactivity is crucial for assessing its potential applications in pharmaceuticals.

Formula: C₁₁H₁₄IN₅O₄

InChI: InChI=1S/C11H14IN5O4/c1-11(20)6(19)4(2-18)21-10(11)17-9-5(7(12)16-17)8(13)14-3-15-9/h3-4,6,10,18-20H,2H2,1H3,(H2,13,14,15)/t4-,6-,10-,11-/m1/s1

InChI key: BHIRDDJQPNTWRK-LCHZXKNMSA-N

SMILES: C[C@]1([C@@H]([C@H](O[C@H]1N2C3=NC=NC(=C3C(=N2)I)N)CO)O)O

3-Iodo-1-(2-C-methyl-b-D-ribofuranosyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine,

CAS: 847551-00-2

Ref: 7W-GN2787