CymitQuimica logo

CAS 84758-55-4

:

Methyl 2-(Boc-amino)-2-methylpropanoate

Description:
Methyl 2-(Boc-amino)-2-methylpropanoate, with the CAS number 84758-55-4, is a chemical compound commonly used in organic synthesis, particularly in the field of medicinal chemistry. It features a tert-butyloxycarbonyl (Boc) protecting group, which is often employed to protect amines during chemical reactions. This compound is characterized by its ester functional group, which contributes to its reactivity and solubility in organic solvents. The presence of the methylpropanoate structure indicates that it has branched alkyl chains, enhancing its steric properties. Methyl 2-(Boc-amino)-2-methylpropanoate is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is generally stable under standard laboratory conditions but should be handled with care due to the potential reactivity of the Boc group under acidic or basic conditions. This compound is valuable in the synthesis of various pharmaceuticals and biologically active molecules, making it an important intermediate in chemical research and development.
Formula:C10H19NO4
InChI:InChI=1S/C10H19NO4/c1-9(2,3)15-8(13)11-10(4,5)7(12)14-6/h1-6H3,(H,11,13)
InChI key:OXGSYLWMSHXMLT-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)NC(C)(C)C(=O)OC
Found 4 products.