CymitQuimica logo

CAS 84758-81-6

:

Tert-Butyl 2-Amino-2-Methyl propanoate Hydrochloride

Description:
Tert-Butyl 2-Amino-2-Methylpropanoate Hydrochloride, with the CAS number 84758-81-6, is a chemical compound that belongs to the class of amino acid derivatives. It is characterized by the presence of a tert-butyl group, which contributes to its hydrophobic properties, and an amino group that imparts basicity. The hydrochloride form indicates that it is a salt, enhancing its solubility in water and making it suitable for various applications in organic synthesis and pharmaceutical formulations. This compound typically appears as a white to off-white crystalline solid. Its structure allows for potential interactions in biological systems, making it of interest in medicinal chemistry. The presence of the amino group suggests that it may participate in peptide bond formation or act as a building block for more complex molecules. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper laboratory practices are followed.
Formula:C8H18ClNO2
InChI:InChI=1S/C8H17NO2.ClH/c1-7(2,3)11-6(10)8(4,5)9;/h9H2,1-5H3;1H
InChI key:YZKDXIFGPWUKTI-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)C(C)(C)N.Cl
Found 5 products.