CymitQuimica logo

CAS 847608-28-0

:

3-Pyridinecarboxylicacid, 4,5,6-trichloro-

Description:
3-Pyridinecarboxylic acid, 4,5,6-trichloro- is an organic compound characterized by its pyridine ring structure substituted with a carboxylic acid group and three chlorine atoms at the 4, 5, and 6 positions. This compound is a derivative of pyridinecarboxylic acid, which is known for its potential applications in pharmaceuticals and agrochemicals. The presence of chlorine substituents enhances its reactivity and may influence its biological activity, making it of interest in various chemical syntheses and research applications. The carboxylic acid functional group contributes to its acidity and solubility in polar solvents, while the chlorinated positions can affect the compound's stability and interaction with biological systems. As with many chlorinated compounds, safety considerations are important due to potential toxicity and environmental impact. Overall, 3-Pyridinecarboxylic acid, 4,5,6-trichloro- is a compound of interest in both synthetic chemistry and applied sciences.
Formula:C6H2Cl3NO2
InChI:InChI=1S/C6H2Cl3NO2/c7-3-2(6(11)12)1-10-5(9)4(3)8/h1H,(H,11,12)
InChI key:GDRLWCPMLULBNF-UHFFFAOYSA-N
SMILES:C1=C(C(=C(C(=N1)Cl)Cl)Cl)C(=O)O
Synonyms:
  • 4,5,6-Trichloronicotinicacid
Found 4 products.