CymitQuimica logo

CAS 84764-41-0

:

1H-Isoindole-1,3(2H)-dione, 2-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-

Description:
1H-Isoindole-1,3(2H)-dione, 2-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]- is a chemical compound characterized by its isoindole core structure, which features a fused bicyclic system containing both a five-membered and a six-membered ring. The presence of the dione functional groups indicates that the compound contains two carbonyl (C=O) groups, contributing to its reactivity and potential applications in organic synthesis. The additional substituent, 2-(2-methyl-1,3-dioxolan-2-yl)ethyl, introduces a dioxolane ring, which is a five-membered cyclic ether that can enhance the compound's solubility and stability. This compound may exhibit interesting biological activities due to its structural features, making it a subject of interest in medicinal chemistry. Its CAS number, 84764-41-0, allows for easy identification in chemical databases. Overall, the unique combination of functional groups and ring structures in this compound suggests potential utility in various chemical applications, including pharmaceuticals and agrochemicals.
Formula:C14H15NO4
InChI:InChI=1S/C14H15NO4/c1-14(18-8-9-19-14)6-7-15-12(16)10-4-2-3-5-11(10)13(15)17/h2-5H,6-9H2,1H3
InChI key:SSOLGKXKNLNMAT-UHFFFAOYSA-N
SMILES:CC1(OCCO1)CCN2C(=O)C3=CC=CC=C3C2=O
Found 4 products.