CymitQuimica logo

CAS 847728-89-6

:

(S)-[1-(4-Bromophenyl)ethyl]carbamic acid tert-butylester

Description:
(S)-[1-(4-Bromophenyl)ethyl]carbamic acid tert-butyl ester is a chemical compound characterized by its specific stereochemistry and functional groups. It features a carbamic acid derivative, where the carbamic acid moiety is esterified with tert-butyl alcohol, resulting in a tert-butyl ester. The presence of the 4-bromophenyl group contributes to its aromatic character and may influence its reactivity and solubility. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its chirality, indicated by the (S) configuration, suggests that it may exhibit specific biological activity or selectivity in interactions with biological targets. The compound's physical properties, such as melting point, boiling point, and solubility, would depend on its molecular structure and the interactions of its functional groups. Safety and handling considerations are essential, particularly due to the presence of the bromine atom, which can impart toxicity. As with all chemical substances, proper laboratory practices should be followed when working with this compound.
Formula:C13H18BrNO2
InChI:InChI=1S/C13H18BrNO2/c1-9(10-5-7-11(14)8-6-10)15-12(16)17-13(2,3)4/h5-9H,1-4H3,(H,15,16)/t9-/m0/s1
InChI key:KECPRZHCNCDSET-VIFPVBQESA-N
SMILES:C[C@@H](C1=CC=C(C=C1)Br)NC(=O)OC(C)(C)C
Found 4 products.