CAS 847756-88-1
:3-Chloro-4-(trifluoromethyl)phenylboronic acid
Description:
3-Chloro-4-(trifluoromethyl)phenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that also features a chlorine atom and a trifluoromethyl group. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. The presence of the boronic acid group makes it a valuable reagent in organic synthesis, particularly in Suzuki coupling reactions, which are widely used for forming carbon-carbon bonds. The trifluoromethyl group enhances the compound's lipophilicity and can influence its reactivity and biological activity. Additionally, the chlorine atom can serve as a site for further substitution reactions. Overall, 3-Chloro-4-(trifluoromethyl)phenylboronic acid is notable for its utility in medicinal chemistry and materials science, where it can be employed in the development of pharmaceuticals and advanced materials. Proper handling and storage are essential due to its potential reactivity and the need for safety precautions when working with boronic acids.
Formula:C7H5BClF3O2
InChI:InChI=1/C7H5BClF3O2/c9-6-3-4(8(13)14)1-2-5(6)7(10,11)12/h1-3,13-14H
SMILES:c1cc(c(cc1B(O)O)Cl)C(F)(F)F
Synonyms:- 3-Chloro-4-(trifluoromethyl)benzeneboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Chloro-4-(trifluoromethyl)benzeneboronic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H5BClF3O2Purity:97%Molecular weight:224.373-Chloro-4-(trifluoromethyl)benzeneboronic acid
CAS:3-Chloro-4-(trifluoromethyl)benzeneboronic acidFormula:C7H5BClF3O2Purity:97%Color and Shape:Off-white SolidMolecular weight:224.37263-Chloro-4-trifluoromethylphenylboronic acid
CAS:Formula:C7H5BClF3O2Purity:98%Color and Shape:SolidMolecular weight:224.37263-Chloro-4-(trifluoromethyl)phenylboronic acid
CAS:Formula:C7H5BClF3O2Purity:98%Color and Shape:Solid, No data available.Molecular weight:224.37



