CymitQuimica logo

CAS 847818-48-8

:

4-Bromo-1-isopentylpyrazole

Description:
4-Bromo-1-isopentylpyrazole is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a bromine atom at the 4-position and an isopentyl group at the 1-position contributes to its unique properties. This compound is typically classified as a heterocyclic organic compound and may exhibit various biological activities, making it of interest in pharmaceutical and agricultural research. Its molecular structure suggests potential interactions with biological systems, particularly in the context of receptor binding or enzyme inhibition. The compound's solubility, stability, and reactivity can vary depending on environmental conditions and the presence of other functional groups. As with many brominated compounds, it may also be subject to specific regulatory considerations due to potential environmental and health impacts. Overall, 4-Bromo-1-isopentylpyrazole represents a class of compounds that can be explored for their synthetic utility and biological significance.
Formula:C8H13BrN2
InChI:InChI=1S/C8H13BrN2/c1-7(2)3-4-11-6-8(9)5-10-11/h5-7H,3-4H2,1-2H3
InChI key:PSQJFVJRFQJOBI-UHFFFAOYSA-N
SMILES:CC(C)CCN1C=C(C=N1)Br
Synonyms:
  • 4-Bromo-1-isopentylpyrazole
  • 4-broMo-1-isopentyl-1H-pyrazole
  • 4-bromo-1-(3-methylbutyl)-1H-pyrazole
  • 1H-Pyrazole, 4-bromo-1-(3-methylbutyl)-
Found 3 products.