CymitQuimica logo

CAS 848066-61-5

:

3-Benzofuranacetamide, 6-methoxy-N-(5-methyl-1,3,4-thiadiazol-2-yl)-

Description:
3-Benzofuranacetamide, 6-methoxy-N-(5-methyl-1,3,4-thiadiazol-2-yl)- is a chemical compound characterized by its unique structural features, which include a benzofuran moiety and a thiadiazole substituent. The presence of the benzofuran ring contributes to its potential biological activity, as this structure is often associated with various pharmacological properties. The methoxy group at the 6-position enhances its lipophilicity, potentially influencing its absorption and distribution in biological systems. The N-(5-methyl-1,3,4-thiadiazol-2-yl) substituent introduces additional functional diversity, which may be responsible for specific interactions with biological targets. This compound may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, although specific biological data would be necessary to confirm these effects. Its CAS number, 848066-61-5, allows for precise identification in chemical databases, facilitating research and development in medicinal chemistry and related fields. Overall, this compound represents a promising candidate for further investigation in drug discovery and development.
Formula:C14H13N3O3S
InChI:InChI=1S/C14H13N3O3S/c1-8-16-17-14(21-8)15-13(18)5-9-7-20-12-6-10(19-2)3-4-11(9)12/h3-4,6-7H,5H2,1-2H3,(H,15,17,18)
InChI key:VRGXJSSFFWOQRP-UHFFFAOYSA-N
SMILES:CC1=NN=C(S1)NC(=O)CC2=COC3=C2C=CC(=C3)OC
Synonyms:
  • 3-Benzofuranacetamide, 6-methoxy-N-(5-methyl-1,3,4-thiadiazol-2-yl)-
  • 3-Benzofuranacetamide, 6-methoxy-N-(5-methyl-1,3,4-thiadiazol-2-yI)-
  • 2-(6-Methoxybenzofuran-3-yl)-N-(5-methyl-1,3,4-thiadiazol-2-yl)acetamide
Found 2 products.