CymitQuimica logo

CAS 848128-91-6

:

8-Quinolinecarbonitrile, 4-hydroxy-

Description:
8-Quinolinecarbonitrile, 4-hydroxy- is an organic compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. This compound features a cyano group (-C≡N) attached to the carbon of the quinoline ring, along with a hydroxyl group (-OH) at the 4-position. The presence of these functional groups contributes to its potential as a versatile building block in organic synthesis and medicinal chemistry. The hydroxyl group can participate in hydrogen bonding, influencing the compound's solubility and reactivity. Additionally, the cyano group can serve as a site for further chemical modifications, making it useful in the development of various derivatives. 8-Quinolinecarbonitrile, 4-hydroxy- may exhibit biological activity, which could be explored for applications in pharmaceuticals or agrochemicals. Its unique structure and functional groups make it a subject of interest for researchers in the fields of organic chemistry and drug development.
Formula:C10H6N2O
InChI:InChI=1S/C10H6N2O/c11-6-7-2-1-3-8-9(13)4-5-12-10(7)8/h1-5H,(H,12,13)
InChI key:VFERFNFGHIWLEM-UHFFFAOYSA-N
SMILES:C1=CC(=C2C(=C1)C(=O)C=CN2)C#N
Synonyms:
  • 4-Hydroxyquinoline-8-carbonitrile
  • 4-Hydroxy-8-cyanoquinoline
Found 3 products.