CymitQuimica logo

CAS 848130-90-5

:

3-Hydroxy-5-methylphenyl benzoate

Description:
3-Hydroxy-5-methylphenyl benzoate, with the CAS number 848130-90-5, is an organic compound characterized by its ester functional group, which is formed from the reaction of benzoic acid and 3-hydroxy-5-methylphenol. This compound typically appears as a solid or crystalline substance and is known for its potential applications in various fields, including pharmaceuticals and materials science. Its molecular structure features a hydroxyl group (-OH) and a methyl group (-CH3) attached to a phenyl ring, contributing to its chemical reactivity and solubility properties. The presence of the ester linkage imparts specific characteristics such as lower volatility compared to its acid or alcohol precursors. Additionally, the compound may exhibit interesting thermal and photostability properties, making it suitable for use in formulations requiring stability under varying conditions. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C14H12O3
InChI:InChI=1/C14H12O3/c1-10-7-12(15)9-13(8-10)17-14(16)11-5-3-2-4-6-11/h2-9,15H,1H3
InChI key:HYLQICWQHBSZQZ-UHFFFAOYSA-N
SMILES:CC1=CC(=CC(=C1)OC(=O)C2=CC=CC=C2)O
Synonyms:
  • 3-Hydroxy-5-methylphenyl benzoate
  • 1,3-benzenediol, 5-methyl-, monobenzoate
  • Benzoic acid 3-Hydroxy-5-methylphenyl ester
  • 3-Hydroxy-5-methylphenyl benzoate
Found 2 products.