CymitQuimica logo

CAS 848178-48-3

:

3-(4-Morpholinylsulfonyl)propanoic acid

Description:
3-(4-Morpholinylsulfonyl)propanoic acid is a chemical compound characterized by its unique structure, which includes a propanoic acid backbone and a morpholine ring substituted with a sulfonyl group. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar solvents like water and methanol, and may have moderate stability under standard conditions. The presence of the morpholine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The sulfonyl group enhances the compound's polarity and can influence its reactivity and biological activity. Additionally, this compound may exhibit acid-base properties due to the carboxylic acid functional group, allowing it to participate in various chemical reactions. Its specific applications and behavior in biological systems would depend on further studies, including its pharmacokinetics and pharmacodynamics. Overall, 3-(4-Morpholinylsulfonyl)propanoic acid represents a versatile structure with potential utility in various chemical and pharmaceutical contexts.
Formula:C7H13NO5S
InChI:InChI=1S/C7H13NO5S/c9-7(10)1-6-14(11,12)8-2-4-13-5-3-8/h1-6H2,(H,9,10)
InChI key:InChIKey=BXZBRLVPYVFGDN-UHFFFAOYSA-N
SMILES:S(CCC(O)=O)(=O)(=O)N1CCOCC1
Synonyms:
  • 3-(4-Morpholinylsulfonyl)propanoic acid
  • Propanoic acid, 3-(4-morpholinylsulfonyl)-
Found 1 products.