CAS 848243-85-6

4H-Thieno[3,2-b]pyrrole-2-carboxylic acid, ethyl ester

Description:

4H-Thieno[3,2-b]pyrrole-2-carboxylic acid, ethyl ester, identified by its CAS number 848243-85-6, is an organic compound characterized by its unique bicyclic structure that incorporates both a thieno and pyrrole moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of both carboxylic acid and ester functional groups. It may participate in various chemical reactions, including esterification and nucleophilic substitutions, making it useful in synthetic organic chemistry. The thieno and pyrrole rings contribute to its electronic properties, which can be advantageous in applications such as organic electronics and materials science. Additionally, the compound may exhibit biological activity, although specific biological properties would require further investigation. Overall, 4H-Thieno[3,2-b]pyrrole-2-carboxylic acid, ethyl ester is a versatile compound with potential applications in various fields, including pharmaceuticals and materials development.

Formula: C9H9NO2S

InChI: InChI=1S/C9H9NO2S/c1-2-12-9(11)8-5-6-7(13-8)3-4-10-6/h3-5,10H,2H2,1H3

InChI key: GTLCVBJBTFWUDH-UHFFFAOYSA-N

SMILES: CCOC(=O)C1=CC2=C(S1)C=CN2

Ethyl 4H-thieno[3,2-b]pyrrole-2-carboxylate

CAS: 848243-85-6

Ethyl 4H-thieno[3,2-b]pyrrole-2-carboxylate

Purity: 97%

Molecular weight: 195.2400055

Ref: 10-F604145

Ethyl 4H-thieno[3,2-b]pyrrole-2-carboxylate

CAS: 848243-85-6

Ethyl 4H-thieno[3,2-b]pyrrole-2-carboxylate

Formula: C₉H₉NO₂S

Purity: ≥95%

Color and Shape: Solid-Crystals

Molecular weight: 195.23826

Ref: 54-OR31846

Ethyl 4H-thieno[3,2-b]pyrrole-2-carboxylate

CAS: 848243-85-6

Versatile small molecule scaffold

Formula: C₉H₉NO₂S

Purity: Min. 95%

Molecular weight: 195.24 g/mol

Ref: 3D-YIB24385