CymitQuimica logo

CAS 84839-57-6

:

Piperidin-4-ylidene-acetic acid hydrochloride

Description:
Piperidin-4-ylidene-acetic acid hydrochloride is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a ylidene group, indicating the presence of a double bond between a carbon atom and a nitrogen atom, contributing to its reactivity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the acetic acid moiety suggests potential acidic properties, which may influence its behavior in biological systems. This compound may exhibit biological activity, making it of interest in medicinal chemistry for the development of therapeutic agents. Its CAS number, 84839-57-6, allows for precise identification and retrieval of information regarding its properties, safety data, and potential applications. Overall, Piperidin-4-ylidene-acetic acid hydrochloride is a versatile compound with significant implications in chemical research and drug development.
Formula:C7H12ClNO2
InChI:InChI=1S/C7H11NO2.ClH/c9-7(10)5-6-1-3-8-4-2-6;/h5,8H,1-4H2,(H,9,10);1H
InChI key:HRTQZNJQEGSCQK-UHFFFAOYSA-N
SMILES:C1CNCCC1=CC(=O)O.Cl
Synonyms:
  • 2-(Piperidin-4-Ylidene)Acetic Acid
  • 2-(Piperidin-4-Ylidene)Acetic Acid Hydrochloride
Found 4 products.