CymitQuimica logo

CAS 848725-96-2

:

1,2-Benzenediamine, 3,4,5,6-tetrabromo-

Description:
1,2-Benzenediamine, 3,4,5,6-tetrabromo- is an organic compound characterized by the presence of a benzene ring substituted with two amino groups and four bromine atoms. The amino groups (-NH2) are located at the 1 and 2 positions of the benzene ring, while the bromine substituents are positioned at the 3, 4, 5, and 6 positions, making it a highly brominated derivative of benzenediamine. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and form. It is known for its potential applications in various fields, including materials science and organic synthesis, due to the reactivity of both the amino and bromine groups. The presence of multiple bromine atoms enhances its reactivity and may impart specific properties such as increased stability or altered solubility in different solvents. Safety precautions are essential when handling this compound, as brominated compounds can be hazardous.
Formula:C6H4Br4N2
InChI:InChI=1S/C6H4Br4N2/c7-1-2(8)4(10)6(12)5(11)3(1)9/h11-12H2
InChI key:GUTZGGJKCYDTHF-UHFFFAOYSA-N
SMILES:C1(=C(C(=C(C(=C1Br)Br)Br)Br)N)N
Found 4 products.