CymitQuimica logo

CAS 848779-31-7

:

Poly(oxy-1,2-ethanediyl), α-hydro-ω-(carboxymethoxy)-, ether with 2,2-bis(hydroxymethyl)-1,3-propanediol (4:1)

Description:
Poly(oxy-1,2-ethanediyl), α-hydro-ω-(carboxymethoxy)-, ether with 2,2-bis(hydroxymethyl)-1,3-propanediol, commonly referred to by its CAS number 848779-31-7, is a complex polyether compound characterized by its hydrophilic properties due to the presence of poly(ethylene glycol) segments. This substance features a carboxymethoxy functional group, which enhances its solubility in water and makes it suitable for various applications in pharmaceuticals, cosmetics, and as a surfactant. The ether linkages contribute to its flexibility and compatibility with other materials. Additionally, the presence of 2,2-bis(hydroxymethyl)-1,3-propanediol provides additional hydroxyl groups, which can facilitate further chemical modifications or cross-linking. This compound is typically non-toxic and biodegradable, making it an attractive option for environmentally friendly formulations. Its unique structure allows for a range of functionalities, including emulsification, stabilization, and as a potential drug delivery system, highlighting its versatility in both industrial and research applications.
Formula:(C2H4O)n(C2H4O)n(C2H4O)n(C2H4O)nC13H20O12
InChI:InChI=1S/C21H36O16/c22-17(23)9-30-1-5-34-13-21(14-35-6-2-31-10-18(24)25,15-36-7-3-32-11-19(26)27)16-37-8-4-33-12-20(28)29/h1-16H2,(H,22,23)(H,24,25)(H,26,27)(H,28,29)
InChI key:QSKWEEVBXSFCPY-UHFFFAOYSA-N
SMILES:C(COCC(COCCOCC(=O)O)(COCCOCC(=O)O)COCCOCC(=O)O)OCC(=O)O
Synonyms:
  • Poly(oxy-1,2-ethanediyl), α-hydro-ω-(carboxymethoxy)-, ether with 2,2-bis(hydroxymethyl)-1,3-propanediol (4:1)
  • 4-ArM PEGn-COOH 2K, 5K, 10K, 20K
Found 6 products.