CymitQuimica logo

CAS 848784-85-0

:

Pulsatilla saponin D

Description:
Pulsatilla saponin D is a triterpenoid saponin derived from the plant species Pulsatilla chinensis, commonly known for its medicinal properties. This compound is characterized by its complex glycosidic structure, which typically includes a hydrophobic aglycone and one or more sugar moieties. Pulsatilla saponin D exhibits various biological activities, including anti-inflammatory, antioxidant, and potential anticancer effects, making it of interest in pharmacological research. Its mechanism of action often involves modulation of cellular signaling pathways and interactions with cell membranes, which can influence cell viability and proliferation. Additionally, saponins like Pulsatilla saponin D are known for their ability to form micelles in solution, which can enhance the solubility and bioavailability of other compounds. However, the specific pharmacokinetics, toxicity, and therapeutic applications of Pulsatilla saponin D require further investigation to fully understand its potential benefits and risks in clinical settings. Overall, this compound represents a significant area of study within natural product chemistry and pharmacognosy.
Formula:C47H76O17
InChI:InChI=1S/C47H76O17/c1-21(2)23-10-15-47(42(57)58)17-16-45(6)24(30(23)47)8-9-28-43(4)13-12-29(44(5,20-49)27(43)11-14-46(28,45)7)63-41-38(64-39-36(55)34(53)31(50)22(3)60-39)33(52)26(19-59-41)62-40-37(56)35(54)32(51)25(18-48)61-40/h22-41,48-56H,1,8-20H2,2-7H3,(H,57,58)/t22-,23-,24+,25+,26-,27+,28+,29-,30+,31-,32+,33-,34+,35-,36+,37+,38+,39-,40-,41-,43-,44-,45+,46+,47-/m0/s1
InChI key:XFCSYQCYIKSNBB-WZGBEVHGSA-N
SMILES:C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@H](CO[C@H]2O[C@H]3CC[C@@]4([C@H]5CC[C@@H]6[C@H]7[C@@H](CC[C@@]7(CC[C@]6([C@@]5(CC[C@H]4[C@]3(C)CO)C)C)C(=O)O)C(=C)C)C)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O)O)O)O)O
Synonyms:
  • (3β)-3-{[6-Deoxy-α-L-mannopyranosyl-(1->2)-[β-D-glucopyranosyl-(1->4)]-α-L-lyxopyranosyl]oxy}-23-hydroxylup-20(29)-en-28-oic acid
Found 3 products.