CymitQuimica logo

CAS 849062-07-3

:

B-[2-[[4-(Trifluoromethoxy)phenoxy]methyl]phenyl]boronic acid

Description:
B-[2-[[4-(Trifluoromethoxy)phenoxy]methyl]phenyl]boronic acid, with CAS number 849062-07-3, is a boronic acid derivative characterized by its unique molecular structure, which includes a boron atom bonded to a phenyl group and a trifluoromethoxy-substituted phenyl moiety. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the trifluoromethoxy group enhances its lipophilicity and may influence its biological activity. Additionally, boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds in organic synthesis. The compound's solubility, stability, and reactivity can vary depending on the solvent and conditions used. Overall, B-[2-[[4-(Trifluoromethoxy)phenoxy]methyl]phenyl]boronic acid is a valuable compound in research and development, particularly in the fields of pharmaceuticals and materials science.
Formula:C14H12BF3O4
InChI:InChI=1S/C14H12BF3O4/c16-14(17,18)22-12-7-5-11(6-8-12)21-9-10-3-1-2-4-13(10)15(19)20/h1-8,19-20H,9H2
InChI key:InChIKey=VVFYLZIEJWOSIP-UHFFFAOYSA-N
SMILES:C(OC1=CC=C(OC(F)(F)F)C=C1)C2=C(B(O)O)C=CC=C2
Synonyms:
  • Boronic acid, [2-[[4-(trifluoromethoxy)phenoxy]methyl]phenyl]-
  • B-[2-[[4-(Trifluoromethoxy)phenoxy]methyl]phenyl]boronic acid
  • Boronic acid, B-[2-[[4-(trifluoromethoxy)phenoxy]methyl]phenyl]-
Found 4 products.