CymitQuimica logo

CAS 849217-48-7

:

1-[(4-Fluorophenyl)carbamoyl]cyclopropanecarboxylic acid

Description:
1-[(4-Fluorophenyl)carbamoyl]cyclopropanecarboxylic acid is a chemical compound characterized by its unique structure, which includes a cyclopropane ring, a carboxylic acid functional group, and a carbamoyl group attached to a para-fluorophenyl moiety. This compound typically exhibits properties associated with both acidic and amide functionalities, making it potentially useful in various chemical applications, including medicinal chemistry. The presence of the fluorine atom can influence the compound's electronic properties, potentially enhancing its biological activity or altering its solubility. The cyclopropane ring contributes to the rigidity of the molecule, which can affect its interaction with biological targets. Additionally, the compound may exhibit specific reactivity patterns due to the presence of the carboxylic acid group, which can participate in hydrogen bonding and other intermolecular interactions. Overall, the unique combination of functional groups in this compound suggests potential utility in pharmaceutical development, particularly in the design of novel therapeutic agents.
Formula:C11H10FNO3
InChI:InChI=1/C11H10FNO3/c12-7-1-3-8(4-2-7)13-9(14)11(5-6-11)10(15)16/h1-4H,5-6H2,(H,13,14)(H,15,16)
InChI key:PFMAFXYUHZDKPY-UHFFFAOYSA-N
SMILES:c1cc(ccc1F)NC(=O)C1(CC1)C(=O)O
Synonyms:
  • 1-(4-Fluorophenylcarbamoyl)Cyclopropanecarboxylic Acid
  • 1-((4-fluorophenyl)carbamoyl)cyclopropanecarboxylic acid
Found 9 products.