CymitQuimica logo

CAS 849600-64-2

:

methyl-1H-imidazole-2-carboxamidine hydrochloride

Description:
Methyl-1H-imidazole-2-carboxamidine hydrochloride is a chemical compound characterized by its imidazole ring structure, which is a five-membered aromatic heterocycle containing nitrogen atoms. This compound features a carboxamidine functional group, which contributes to its potential biological activity. It is typically encountered as a hydrochloride salt, enhancing its solubility in aqueous solutions, making it suitable for various applications in biochemical research and pharmaceutical development. The presence of the methyl group on the imidazole ring can influence its reactivity and interaction with biological targets. Methyl-1H-imidazole-2-carboxamidine hydrochloride is often studied for its role in enzyme inhibition and as a potential therapeutic agent, particularly in the context of diseases where modulation of specific biochemical pathways is desired. Its stability, solubility, and reactivity are important characteristics that dictate its utility in laboratory settings. As with many chemical substances, proper handling and safety precautions are essential due to its potential biological effects.
Formula:C5H9ClN4
InChI:InChI=1S/C5H8N4.ClH/c1-9-3-2-8-5(9)4(6)7;/h2-3H,1H3,(H3,6,7);1H
InChI key:WJQAKFRHCZWOKB-UHFFFAOYSA-N
SMILES:Cn1ccnc1C(=N)N.Cl
Synonyms:
  • 1H-Imidazole-2-carboximidamide, 1-methyl-, monohydrochloride
  • 1-methyl-1H-imidazole-2-carboximidamide hydrochloride
Found 3 products.