CymitQuimica logo

CAS 849925-05-9

:

1,2,4-Oxadiazole-5-propanoicacid, 3-(2-pyrazinyl)-

Description:
1,2,4-Oxadiazole-5-propanoic acid, 3-(2-pyrazinyl)-, identified by CAS number 849925-05-9, is a heterocyclic compound featuring an oxadiazole ring, which is a five-membered aromatic ring containing two nitrogen atoms and three carbon atoms. This compound is characterized by its unique structural features, including a propanoic acid functional group and a pyrazine moiety, which contribute to its potential biological activity. The presence of the oxadiazole and pyrazine rings suggests that it may exhibit interesting pharmacological properties, possibly acting as a bioactive agent in medicinal chemistry. The compound is likely to be soluble in polar solvents due to the carboxylic acid group, while the heterocyclic rings may impart stability and influence its reactivity. Additionally, the presence of nitrogen atoms in the structure can enhance its interactions with biological targets, making it a candidate for further research in drug development and other applications in organic synthesis.
Formula:C9H8N4O3
InChI:InChI=1S/C9H8N4O3/c14-8(15)2-1-7-12-9(13-16-7)6-5-10-3-4-11-6/h3-5H,1-2H2,(H,14,15)
InChI key:DMKXMTRMGQYKFM-UHFFFAOYSA-N
SMILES:C1=CN=C(C=N1)C2=NOC(=N2)CCC(=O)O
Synonyms:
  • 1,2,4-Oxadiazole-5-propanoicacid, 3-pyrazinyl- (9CI)
Found 4 products.