CymitQuimica logo

CAS 849928-22-9

:

tert-butyl 4-oxospiro[chroman-2,4'-piperidine]-1'-carboxylate

Description:
Tert-butyl 4-oxospiro[chroman-2,4'-piperidine]-1'-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which combines a chroman moiety with a piperidine ring. This compound features a tert-butyl ester functional group, contributing to its solubility and reactivity. The presence of the 4-oxo group indicates a ketone functionality, which can participate in various chemical reactions, including nucleophilic additions. The spiro arrangement of the chroman and piperidine rings introduces rigidity and can influence the compound's biological activity and pharmacokinetic properties. Typically, compounds of this nature may exhibit interesting pharmacological profiles, making them potential candidates for drug development. The molecular structure suggests potential interactions with biological targets, which could be explored in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the steric hindrance provided by the tert-butyl group, affecting its synthesis and application in various chemical contexts. Overall, tert-butyl 4-oxospiro[chroman-2,4'-piperidine]-1'-carboxylate represents a complex and potentially bioactive molecule within organic and medicinal chemistry.
Formula:C18H23NO4
InChI:InChI=1/C18H23NO4/c1-17(2,3)23-16(21)19-10-8-18(9-11-19)12-14(20)13-6-4-5-7-15(13)22-18/h4-7H,8-12H2,1-3H3
InChI key:UBIJXGGLEBMDOG-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC2(CC1)CC(=O)c1ccccc1O2
Synonyms:
  • 4-Oxo-2-Spiro(N-Boc-Piperidine-4-Yl)-Benzopyran
Found 5 products.