CymitQuimica logo

CAS 849938-78-9

:

Piperazine,1-[4-fluoro-2-(methylsulfonyl)phenyl]-

Description:
Piperazine, 1-[4-fluoro-2-(methylsulfonyl)phenyl]- is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a 4-fluoro substituent and a methylsulfonyl group attached to a phenyl ring, contributing to its unique chemical properties. The presence of the fluorine atom enhances the compound's lipophilicity and may influence its biological activity, while the methylsulfonyl group can enhance solubility and reactivity. Piperazine derivatives are often studied for their pharmacological potential, including applications in the development of pharmaceuticals, particularly in the fields of psychiatry and neurology. The compound's molecular structure suggests potential interactions with various biological targets, making it of interest in medicinal chemistry. Additionally, its CAS number, 849938-78-9, serves as a unique identifier for regulatory and safety information. As with any chemical substance, understanding its properties, including solubility, stability, and reactivity, is crucial for safe handling and application in research or industry.
Formula:C11H15FN2O2S
InChI:InChI=1S/C11H15FN2O2S/c1-17(15,16)11-8-9(12)2-3-10(11)14-6-4-13-5-7-14/h2-3,8,13H,4-7H2,1H3
InChI key:DZTMMTKMPVAHPW-UHFFFAOYSA-N
SMILES:CS(=O)(=O)C1=C(C=CC(=C1)F)N2CCNCC2
Synonyms:
  • 1-(4-Fluoro-2-(methylsulfonyl)phenyl)piperazine
Found 2 products.