CymitQuimica logo

CAS 850349-72-3

:

1-Boc-5-bromo-3-iodoindole

Description:
1-Boc-5-bromo-3-iodoindole is a chemical compound that belongs to the indole family, characterized by the presence of both bromine and iodine substituents on the indole ring. The "Boc" (tert-butyloxycarbonyl) group is a protective group commonly used in organic synthesis, particularly in the context of amine protection. This compound typically exhibits moderate to high lipophilicity due to the presence of halogen atoms, which can influence its reactivity and solubility in organic solvents. The bromine and iodine substituents can participate in various chemical reactions, such as nucleophilic substitutions or cross-coupling reactions, making this compound valuable in synthetic organic chemistry and medicinal chemistry. Additionally, the presence of the Boc group allows for further functionalization or deprotection steps in synthetic pathways. Overall, 1-Boc-5-bromo-3-iodoindole serves as an important intermediate in the synthesis of more complex molecules, particularly in the development of pharmaceuticals and biologically active compounds.
Formula:C13H13BrINO2
InChI:InChI=1/C13H13BrINO2/c1-13(2,3)18-12(17)16-7-10(15)9-6-8(14)4-5-11(9)16/h4-7H,1-3H3
InChI key:MCFJOLCLHJYCDS-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)n1cc(c2cc(ccc12)Br)I
Synonyms:
  • 5-Bromo-3-iodoindole-1-carboxylic acid tert-butyl ester
  • Tert-Butyl 5-Bromo-3-Iodo-Indole-1-Carboxylate
  • 1H-Indole-1-carboxylic acid, 5-bromo-3-iodo-, 1,1-dimethylethyl ester
Found 5 products.