CymitQuimica logo

CAS 850364-08-8

:

1H-Indazole,4-(phenylmethoxy)-

Description:
1H-Indazole, 4-(phenylmethoxy)- is an organic compound characterized by its indazole core, which consists of a five-membered ring containing two nitrogen atoms. The presence of a phenylmethoxy group at the 4-position of the indazole structure enhances its chemical properties, potentially influencing its reactivity and solubility. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. The compound is likely to be a solid at room temperature and may have moderate to low solubility in water, typical of many indazole derivatives. Additionally, it may undergo typical organic reactions such as substitution or oxidation, depending on the functional groups present. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Overall, 1H-Indazole, 4-(phenylmethoxy)- represents a class of compounds that could be valuable in research and pharmaceutical contexts.
Formula:C14H12N2O
InChI:InChI=1S/C14H12N2O/c1-2-5-11(6-3-1)10-17-14-8-4-7-13-12(14)9-15-16-13/h1-9H,10H2,(H,15,16)
InChI key:KTYOLSBHUABXAW-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)COC2=CC=CC3=C2C=NN3
Synonyms:
  • 4-Benzyloxy-1H-indazole
Found 6 products.