CAS 850364-08-8
:1H-Indazole,4-(phenylmethoxy)-
Description:
1H-Indazole, 4-(phenylmethoxy)- is an organic compound characterized by its indazole core, which consists of a five-membered ring containing two nitrogen atoms. The presence of a phenylmethoxy group at the 4-position of the indazole structure enhances its chemical properties, potentially influencing its reactivity and solubility. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. The compound is likely to be a solid at room temperature and may have moderate to low solubility in water, typical of many indazole derivatives. Additionally, it may undergo typical organic reactions such as substitution or oxidation, depending on the functional groups present. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Overall, 1H-Indazole, 4-(phenylmethoxy)- represents a class of compounds that could be valuable in research and pharmaceutical contexts.
Formula:C14H12N2O
InChI:InChI=1S/C14H12N2O/c1-2-5-11(6-3-1)10-17-14-8-4-7-13-12(14)9-15-16-13/h1-9H,10H2,(H,15,16)
InChI key:KTYOLSBHUABXAW-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)COC2=CC=CC3=C2C=NN3
Synonyms:- 4-Benzyloxy-1H-indazole
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
4-(Benzyloxy)-1H-indazole
CAS:4-(Benzyloxy)-1H-indazoleFormula:C14H11N2OPurity:95%Molecular weight:223.254-(Benzyloxy)-1H-indazole
CAS:Formula:C14H12N2OPurity:97%Color and Shape:SolidMolecular weight:224.25794-(Benzyloxy)-1H-indazole
CAS:4-(Benzyloxy)-1H-indazoleFormula:C14H12N2OPurity:97%Molecular weight:224.264-(Benzyloxy)-1H-indazole
CAS:4-(Benzyloxy)-1H-indazole is a chemical compound that is synthesized by the reaction of 4-hydroxy-1H-indazole with benzyl bromide. This reaction proceeds through two steps: 1) diazotization and 2) aminolysis. The isoamyl acetate produced in step 1 reacts with the indazole in step 2 to produce 4-(benzyloxy)-1H-indazole. The reaction temperature for this process should be kept at or below 40°C, as it can result in a low yield of product. This chemical compound has been used as a nucleophile in various reactions and has been shown to react with nitrite ions to form an azine derivative.Formula:C14H12N2OPurity:Min. 95%Molecular weight:224.26 g/mol




