CymitQuimica logo

CAS 850411-07-3

:

ethyl [3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetate

Description:
Ethyl [3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetate is an organic compound characterized by its complex structure, which includes an ethyl acetate moiety and a phenoxy group substituted with a boron-containing dioxaborolane. This compound typically exhibits properties associated with both esters and boron compounds, such as moderate polarity and potential reactivity due to the presence of the boron atom. The dioxaborolane ring contributes to its stability and may facilitate specific chemical reactions, particularly in organic synthesis and medicinal chemistry. The presence of the ethyl group enhances its solubility in organic solvents, making it suitable for various applications in chemical research and development. Additionally, the compound may exhibit interesting biological activities, which can be explored in pharmaceutical contexts. Overall, its unique structural features make it a valuable compound for further study in synthetic organic chemistry and related fields.
Formula:C16H23BO5
InChI:InChI=1/C16H23BO5/c1-6-19-14(18)11-20-13-9-7-8-12(10-13)17-21-15(2,3)16(4,5)22-17/h7-10H,6,11H2,1-5H3
InChI key:IUEPWIKFOCKVEU-UHFFFAOYSA-N
SMILES:CCOC(=O)COc1cccc(c1)B1OC(C)(C)C(C)(C)O1
Found 4 products.