CymitQuimica logo

CAS 850568-20-6

:

[4-(prop-2-en-1-ylcarbamoyl)phenyl]boronic acid

Description:
[4-(Prop-2-en-1-ylcarbamoyl)phenyl]boronic acid is an organic compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols. This compound features a phenyl ring substituted with a prop-2-en-1-ylcarbamoyl group, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The boronic acid moiety allows for participation in Suzuki-Miyaura cross-coupling reactions, making it valuable in the formation of carbon-carbon bonds. Additionally, the presence of the carbamoyl group may enhance its solubility and interaction with biological targets, suggesting potential applications in drug development. The compound's structure indicates it may exhibit unique properties such as pH sensitivity and the ability to act as a ligand in coordination chemistry. Overall, [4-(prop-2-en-1-ylcarbamoyl)phenyl]boronic acid is a versatile building block in synthetic organic chemistry with implications in various fields, including pharmaceuticals and materials science.
Formula:C12H16BNO5
InChI:InChI=1/C12H16BNO5/c1-2-19-11(15)7-8-14-12(16)9-3-5-10(6-4-9)13(17)18/h3-6,17-18H,2,7-8H2,1H3,(H,14,16)
InChI key:WZVRLQMDCATRNQ-UHFFFAOYSA-N
SMILES:CCOC(=O)CCNC(=O)c1ccc(cc1)B(O)O
Synonyms:
  • [4-(Allylcarbamoyl)phenyl]boronic acid
  • boronic acid, B-[4-[(2-propen-1-ylamino)carbonyl]phenyl]-
  • [4-[(3-Ethoxy-3-Oxo-Propyl)Carbamoyl]Phenyl]Boronic Acid
Found 4 products.