CymitQuimica logo

CAS 850568-24-0

:

methyl N-{[4-(dihydroxyboranyl)phenyl]carbonyl}glycinate

Description:
Methyl N-{[4-(dihydroxyboranyl)phenyl]carbonyl}glycinate, with the CAS number 850568-24-0, is a chemical compound that features a boron-containing moiety, specifically a dihydroxyboranyl group, which is known for its potential applications in medicinal chemistry and materials science. This compound is characterized by the presence of a glycine derivative, which contributes to its biological activity and solubility properties. The carbonyl group linked to the phenyl ring enhances its reactivity, making it a candidate for various chemical transformations. The dihydroxyboranyl group can participate in coordination chemistry, potentially forming complexes with other molecules. Additionally, the presence of hydroxyl groups may impart unique hydrogen bonding capabilities, influencing the compound's physical properties such as melting point and solubility in different solvents. Overall, this compound's structure suggests it may exhibit interesting pharmacological properties, warranting further investigation in drug development and synthetic applications.
Formula:C12H14BNO4
InChI:InChI=1/C12H14BNO4/c15-11-5-7-14(8-6-11)12(16)9-1-3-10(4-2-9)13(17)18/h1-4,17-18H,5-8H2
InChI key:YKJICAYIUOGMGH-UHFFFAOYSA-N
SMILES:c1cc(ccc1C(=O)N1CCC(=O)CC1)B(O)O
Synonyms:
  • {4-[(4-Oxopiperidin-1-yl)carbonyl]phenyl}boronic acid
  • boronic acid, B-[4-[(4-oxo-1-piperidinyl)carbonyl]phenyl]-
  • 4-(4-Oxopiperidin-1-ylcarbonyl)benzeneboronicacid
Found 4 products.