CAS 850583-75-4
:3,6-Dithiophen-2-yl-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione
Description:
3,6-Dithiophen-2-yl-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione is a complex organic compound characterized by its unique bicyclic structure that incorporates both pyrrole and dione functionalities. This compound features a fused ring system, which contributes to its potential electronic properties, making it of interest in organic electronics and materials science. The presence of thiophene groups enhances its conjugation and may improve its conductivity and stability. Typically, compounds of this nature exhibit interesting optical properties, including strong absorption in the visible region, which can be advantageous for applications in organic photovoltaics or light-emitting devices. Additionally, the dione moiety can participate in various chemical reactions, potentially allowing for further functionalization. The compound's solubility, stability, and reactivity can vary based on its molecular structure and substituents, influencing its practical applications in research and industry. Overall, 3,6-Dithiophen-2-yl-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione represents a significant area of study within organic chemistry and materials science.
Formula:C14H8N2O2S2
InChI:1S/C14H8N2O2S2/c17-13-9-10(12(16-13)8-4-2-6-20-8)14(18)15-11(9)7-3-1-5-19-7/h1-6H,(H,15,18)(H,16,17)
Synonyms:- 3,6-Di(2-thienyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione
- 1,4-Bis(2-thienyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-3,6-dione
- 3,6-Di(thiophen-2-yl)pyrrolo[3,4-C]pyrrole-1,4(2H,5H)-dione
- Pyrrolo[3,4-C]pyrrole-1,4-dione, 2,5-dihydro-3,6-di-2-thienyl-
- 2,5-Dihydro-1,4-dioxo-3,6-dithienylpyrrolo[3,4-C]-pyrrole
- 2,5-dihydro-3,6-di-2-thienyl-Pyrrolo[3,4-c]pyrrole-1,4-dione
- K0504
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3,6-Di(2-thienyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione
CAS:Formula:C14H8N2O2S2Purity:>95.0%(HPLC)(N)Color and Shape:Dark green to Dark red to Black powder to crystalMolecular weight:300.353,6-DI(THIOPHEN-2-YL)PYRROLO[3,4-C]PYRROLE-1,4(2H,5H)-DIONE
CAS:Formula:C14H8N2O2S2Purity:95%Color and Shape:SolidMolecular weight:300.35553,6-Di(thiophen-2-yl)pyrrolo[3,4-c]pyrrole-1,4(2H,5H)-dione
CAS:3,6-Di(thiophen-2-yl)pyrrolo[3,4-c]pyrrole-1,4(2H,5H)-dioneFormula:C14H8N2O2S2Purity:95%Color and Shape:SolidMolecular weight:300.363,6-Di(thiophen-2-yl)pyrrolo[3,4-c]pyrrole-1,4(2H,5H)-dione
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:300.35000610351563,6-Di(2-thienyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione
CAS:3,6-Di(2-thienyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione is a hyaluronic acid derivative that is being studied as a possible treatment for cancer. It has been shown to have tumor suppressive effects on human breast and prostate cancer cells in vitro. The mechanism of action is thought to be related to the redox potentials of the molecule. 3,6-Di(2-thienyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione can be used as an optical probe for studying interactions between molecules in solution. It can also be used in optical absorption spectroscopy to measure changes in tumor tissue and as an acceptor for potentials.Purity:Min. 95%




