CAS 850589-44-5
:B-[3-Chloro-4-[(cyclopropylamino)carbonyl]phenyl]boronic acid
Description:
B-[3-Chloro-4-[(cyclopropylamino)carbonyl]phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and is widely used in organic synthesis and medicinal chemistry. The compound features a chlorinated phenyl ring, which enhances its reactivity and potential biological activity. The cyclopropylamino group contributes to its structural complexity and may influence its interaction with biological targets. This compound is typically utilized in the development of pharmaceuticals, particularly in the context of drug discovery and development, where boronic acids are valuable for their role in various coupling reactions, such as Suzuki-Miyaura cross-coupling. Additionally, the presence of the boronic acid moiety allows for potential applications in targeted therapies, especially in cancer treatment, due to its ability to modulate biological pathways. Overall, B-[3-Chloro-4-[(cyclopropylamino)carbonyl]phenyl]boronic acid exemplifies the versatility and significance of boronic acids in modern chemistry.
Formula:C10H11BClNO3
InChI:InChI=1S/C10H11BClNO3/c12-9-5-6(11(15)16)1-4-8(9)10(14)13-7-2-3-7/h1,4-5,7,15-16H,2-3H2,(H,13,14)
InChI key:InChIKey=TUPWHDSMIIRKLY-UHFFFAOYSA-N
SMILES:C(NC1CC1)(=O)C2=C(Cl)C=C(B(O)O)C=C2
Synonyms:- (3-Chloro-4-(cyclopropylcarbamoyl)phenyl)boronicacid
- 3-Chloro-4-(cyclopropylcarbamoyl)benzeneboronic acid
- B-[3-Chloro-4-[(cyclopropylamino)carbonyl]phenyl]boronic acid
- Boronic acid, B-[3-chloro-4-[(cyclopropylamino)carbonyl]phenyl]-
- Boronic acid, [3-chloro-4-[(cyclopropylamino)carbonyl]phenyl]-
- [3-Chloro-4-(cyclopropylcarbamoylcarbonyl)phenyl]boronic acid
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
3-Chloro-4-(cyclopropylcarbamoyl)benzeneboronic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C10H11BClNO3Purity:97%Molecular weight:239.463-Chloro-4-(cyclopropylcarbamoyl)benzeneboronic acid
CAS:3-Chloro-4-(cyclopropylcarbamoyl)benzeneboronic acidFormula:C10H11BClNO3Purity:98%Color and Shape:PowderMolecular weight:239.463243-Chloro-4-(cyclopropylcarbamoyl)phenylboronic acid
CAS:Formula:C10H11BClNO3Purity:98%Color and Shape:SolidMolecular weight:239.4632(3-Chloro-4-(cyclopropylcarbamoyl)phenyl)boronic acid
CAS:(3-Chloro-4-(cyclopropylcarbamoyl)phenyl)boronic acidFormula:C10H11BClNO3Purity:98%Molecular weight:239.46(3-Chloro-4-(cyclopropylcarbamoyl)phenyl)boronic acid
CAS:Formula:C10H11BClNO3Purity:98%Molecular weight:239.46




