CymitQuimica logo

CAS 850589-44-5

:

B-[3-Chloro-4-[(cyclopropylamino)carbonyl]phenyl]boronic acid

Description:
B-[3-Chloro-4-[(cyclopropylamino)carbonyl]phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and is widely used in organic synthesis and medicinal chemistry. The compound features a chlorinated phenyl ring, which enhances its reactivity and potential biological activity. The cyclopropylamino group contributes to its structural complexity and may influence its interaction with biological targets. This compound is typically utilized in the development of pharmaceuticals, particularly in the context of drug discovery and development, where boronic acids are valuable for their role in various coupling reactions, such as Suzuki-Miyaura cross-coupling. Additionally, the presence of the boronic acid moiety allows for potential applications in targeted therapies, especially in cancer treatment, due to its ability to modulate biological pathways. Overall, B-[3-Chloro-4-[(cyclopropylamino)carbonyl]phenyl]boronic acid exemplifies the versatility and significance of boronic acids in modern chemistry.
Formula:C10H11BClNO3
InChI:InChI=1S/C10H11BClNO3/c12-9-5-6(11(15)16)1-4-8(9)10(14)13-7-2-3-7/h1,4-5,7,15-16H,2-3H2,(H,13,14)
InChI key:InChIKey=TUPWHDSMIIRKLY-UHFFFAOYSA-N
SMILES:C(NC1CC1)(=O)C2=C(Cl)C=C(B(O)O)C=C2
Synonyms:
  • (3-Chloro-4-(cyclopropylcarbamoyl)phenyl)boronicacid
  • 3-Chloro-4-(cyclopropylcarbamoyl)benzeneboronic acid
  • B-[3-Chloro-4-[(cyclopropylamino)carbonyl]phenyl]boronic acid
  • Boronic acid, B-[3-chloro-4-[(cyclopropylamino)carbonyl]phenyl]-
  • Boronic acid, [3-chloro-4-[(cyclopropylamino)carbonyl]phenyl]-
  • [3-Chloro-4-(cyclopropylcarbamoylcarbonyl)phenyl]boronic acid
Found 5 products.