CymitQuimica logo

CAS 850589-46-7

:

[4-(tert-butylcarbamoyl)-3-chloro-phenyl]boronic acid

Description:
[4-(tert-butylcarbamoyl)-3-chloro-phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and is widely used in organic synthesis and medicinal chemistry. The compound features a chloro-substituted phenyl ring, which can influence its reactivity and solubility. The tert-butylcarbamoyl group enhances the compound's stability and solubility in organic solvents, making it suitable for various applications, including drug development and as a building block in the synthesis of complex molecules. The boronic acid moiety allows for participation in Suzuki-Miyaura cross-coupling reactions, a key method for forming carbon-carbon bonds. Additionally, the compound's unique structure may impart specific biological activities, making it of interest in pharmaceutical research. Overall, [4-(tert-butylcarbamoyl)-3-chloro-phenyl]boronic acid exemplifies the versatility of boronic acids in synthetic chemistry and their potential utility in various applications.
Formula:C11H15BClNO3
InChI:InChI=1/C11H15BClNO3/c1-11(2,3)14-10(15)8-5-4-7(12(16)17)6-9(8)13/h4-6,16-17H,1-3H3,(H,14,15)
InChI key:RFTCLOPBDGFPDR-UHFFFAOYSA-N
SMILES:CC(C)(C)N=C(c1ccc(cc1Cl)B(O)O)O
Found 3 products.