CymitQuimica logo

CAS 850593-12-3

:

[2-isopropoxy-5-(trifluoromethyl)phenyl]boronic acid

Description:
[2-Isopropoxy-5-(trifluoromethyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with both an isopropoxy group and a trifluoromethyl group, which can influence its reactivity and solubility. The trifluoromethyl group is known for imparting unique electronic properties, enhancing lipophilicity, and potentially affecting the compound's biological activity. The boronic acid moiety allows for participation in Suzuki-Miyaura cross-coupling reactions, making it valuable in the synthesis of complex organic molecules. Additionally, the presence of the isopropoxy group may enhance the compound's stability and solubility in organic solvents. Overall, this compound exemplifies the versatility of boronic acids in synthetic chemistry and their role in developing pharmaceuticals and agrochemicals.
Formula:C10H12BF3O3
InChI:InChI=1/C10H12BF3O3/c1-6(2)17-9-4-3-7(10(12,13)14)5-8(9)11(15)16/h3-6,15-16H,1-2H3
InChI key:CHIZGUWFZKIYSO-UHFFFAOYSA-N
SMILES:CC(C)Oc1ccc(cc1B(O)O)C(F)(F)F
Found 4 products.