CAS 85092-83-7
:3-Bromo-5-methoxy-1H-indole
Description:
3-Bromo-5-methoxy-1H-indole is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a bromine atom at the 3-position and a methoxy group at the 5-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in organic solvents such as ethanol and dichloromethane, but may have limited solubility in water due to its hydrophobic indole core. It is often used in research and development, particularly in the fields of medicinal chemistry and biochemistry, due to its potential biological activities, including antimicrobial and anticancer properties. The bromine substituent can also facilitate further chemical modifications, making it a versatile intermediate in organic synthesis. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled. Proper storage in a cool, dry place away from light is recommended to maintain its stability.
Formula:C9H8BrNO
InChI:InChI=1/C9H8BrNO/c1-12-6-2-3-9-7(4-6)8(10)5-11-9/h2-5,11H,1H3
Synonyms:- 3-Bromo-5-methoxy-1h-indole
- 1H-indole, 3-bromo-5-methoxy-
- 3-Bromo-5-methoxyindole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
3-Bromo-5-methoxy-1H-indole
CAS:3-Bromo-5-methoxy-1H-indole is an indole that can be synthesized in two steps from 3,4-dibromobenzene. It is a potassium salt that reacts with potassium t-butoxide to produce a mixture of potassium bis(3-bromoindolyl) and potassium bis(5-methoxyanilino). The product can be purified by recrystallization. 3-Bromo-5-methoxy-1H-indole has been used for Suzuki coupling reactions with various boronic acids or boronates.Formula:C9H8BrNOPurity:Min. 95%Molecular weight:226.07 g/mol
