CymitQuimica logo

CAS 851376-05-1

:

Pyrazolo[3,4-d]azepine,3-(4-chlorophenyl)-1,4,5,6,7,8-hexahydro-1-(phenylmethyl)-,2-hydroxy-1,2,3-propanetricarboxylate (1:1)

Description:
Pyrazolo[3,4-d]azepine, 3-(4-chlorophenyl)-1,4,5,6,7,8-hexahydro-1-(phenylmethyl)-,2-hydroxy-1,2,3-propanetricarboxylate (1:1) is a complex organic compound characterized by its unique bicyclic structure, which incorporates both a pyrazolo and an azepine moiety. This compound features multiple functional groups, including a chlorophenyl substituent and a tricarboxylate ester, contributing to its potential biological activity. The presence of the hexahydro framework indicates a saturated ring system, which may influence its reactivity and interactions with biological targets. The hydroxyl group suggests potential for hydrogen bonding, enhancing solubility and reactivity in various environments. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its specific interactions and efficacy would depend on further studies, including in vitro and in vivo evaluations. As with many complex organic compounds, careful consideration of its synthesis, stability, and safety profile is essential for practical applications.
Formula:C20H20ClN3C6H8O7
InChI:InChI=1S/C20H20ClN3.C6H8O7/c21-17-8-6-16(7-9-17)20-18-10-12-22-13-11-19(18)24(23-20)14-15-4-2-1-3-5-15;7-3(8)1-6(13,5(11)12)2-4(9)10/h1-9,22H,10-14H2;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)
InChI key:DIQZMBPDLFAJLK-UHFFFAOYSA-N
SMILES:C1CNCCC2=C1C(=NN2CC3=CC=CC=C3)C4=CC=C(C=C4)Cl.C(C(=O)O)C(CC(=O)O)(C(=O)O)O
Found 4 products.