CymitQuimica logo

CAS 851386-32-8

:

4-Chloro-5,6-difluoro-3-pyridinecarboxylic acid

Description:
4-Chloro-5,6-difluoro-3-pyridinecarboxylic acid is a heterocyclic organic compound characterized by its pyridine ring, which is substituted with a carboxylic acid group and halogen atoms. The presence of chlorine and fluorine atoms introduces unique electronic and steric properties, influencing its reactivity and potential applications. This compound typically exhibits moderate solubility in polar solvents due to the carboxylic acid functional group, while the halogen substitutions can enhance lipophilicity. It may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it valuable in pharmaceutical and agrochemical research. The compound's structure suggests potential biological activity, which could be explored in drug development. Additionally, its CAS number, 851386-32-8, serves as a unique identifier for regulatory and safety information. Overall, 4-Chloro-5,6-difluoro-3-pyridinecarboxylic acid is a compound of interest in synthetic chemistry and material science due to its distinctive properties and functional groups.
Formula:C6H2ClF2NO2
InChI:InChI=1S/C6H2ClF2NO2/c7-3-2(6(11)12)1-10-5(9)4(3)8/h1H,(H,11,12)
InChI key:InChIKey=SQMYITSFQKNMHA-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(Cl)=C(F)C(F)=NC1
Synonyms:
  • 3-Pyridinecarboxylic Acid, 4-Chloro-5,6-Difluoro-
  • 4-Chloro-5,6-difluoro-3-pyridinecarboxylic acid
  • 4-Chloro-5,6-difluoronicotinic acid
  • 4-Chloro-5,6-difluoropyridine-3-carboxylic acid
  • 4-Chloro-5,6-difluoropyridine-3-carboxylic acid 95%
  • 4-Chloro-5,6-difluoropyridine-3-carboxylic acid ISO 9001:2015 REACH
  • 4-chloro-5,6-difluoronicotinicacid
Found 4 products.