CymitQuimica logo

CAS 852180-70-2

:

3-(5-Methyl-1,2,4-oxadiazol-3-yl)benzenemethanol

Description:
3-(5-Methyl-1,2,4-oxadiazol-3-yl)benzenemethanol is a chemical compound characterized by its unique structure, which includes a benzenemethanol moiety and a 5-methyl-1,2,4-oxadiazole ring. The presence of the oxadiazole ring contributes to its potential biological activity, as oxadiazoles are known for their diverse pharmacological properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water, which is common for many organic compounds with aromatic structures. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The hydroxymethyl group can participate in hydrogen bonding, influencing its reactivity and interactions. Additionally, the methyl group on the oxadiazole ring may affect the compound's lipophilicity and overall stability. As with many synthetic organic compounds, the specific characteristics such as melting point, boiling point, and spectral data would need to be determined experimentally for precise applications in research or industry.
Formula:C10H10N2O2
InChI:InChI=1/C10H10N2O2/c1-7-11-10(12-14-7)9-4-2-3-8(5-9)6-13/h2-5,13H,6H2,1H3
InChI key:InChIKey=KCLCEECIUZDIGI-UHFFFAOYSA-N
SMILES:C(O)C=1C=C(C=CC1)C=2N=C(C)ON2
Synonyms:
  • 3-(5-Methyl-1,2,4-oxadiazol-3-yl)benzenemethanol
  • Benzenemethanol, 3-(5-methyl-1,2,4-oxadiazol-3-yl)-
  • See more synonyms
Found 3 products.