CAS 85232-02-6
:Butoxycarbonylphosphoramidicaciddiethylester
Description:
Butoxycarbonylphosphoramidic acid diethyl ester, identified by its CAS number 85232-02-6, is a chemical compound that belongs to the class of phosphoramidates. This substance typically features a phosphorous atom bonded to an amine and an ester group, which contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The butoxycarbonyl group serves as a protective group, enhancing the stability of the molecule during various chemical reactions. It is often utilized in the synthesis of phosphoramidate derivatives, which can exhibit biological activity, including potential use as prodrugs or in the development of pharmaceuticals. The compound is generally characterized by its moderate solubility in organic solvents and may exhibit specific reactivity patterns typical of phosphorous-containing compounds. Safety data should be consulted for handling and storage, as phosphoramidates can pose health risks if not managed properly. Overall, Butoxycarbonylphosphoramidic acid diethyl ester is a versatile compound with significant implications in chemical research and development.
Formula:C9H20NO5P
InChI:InChI=1/C9H20NO5P/c1-6-13-16(12,14-7-2)10-8(11)15-9(3,4)5/h6-7H2,1-5H3,(H,10,11,12)
SMILES:CCOP(=O)(N=C(O)OC(C)(C)C)OCC
Synonyms:- N-(tert-butoxycarbonyl)phosphoramidic acid diethyl ester
- Tert-Butyl (Diethoxyphosphoryl)Carbamate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Diethyl N-(Tert-Butoxycarbonyl)Phosphoramidate
CAS:Diethyl N-(Tert-Butoxycarbonyl)PhosphoramidateFormula:C9H20NO5PPurity:98%Molecular weight:253.23N-(Tert-butoxycarbonyl)phosphoramidic acid diethyl ester
CAS:Formula:C9H20NO5PPurity:95%Color and Shape:SolidMolecular weight:253.2326Diethyl N-(tert-Butoxycarbonyl)phosphoramidate
CAS:Formula:C9H20NO5PPurity:>98.0%(N)Color and Shape:White to Almost white powder to crystalMolecular weight:253.23Diethyl N-(tert-Butoxycarbonyl)phosphoramidate
CAS:Diethyl N-(tert-Butoxycarbonyl)phosphoramidate is a chemical compound that is used in coupling reactions. It has a magnetic resonance and can be used to detect the presence of certain elements. Diethyl N-(tert-Butoxycarbonyl)phosphoramidate shifts at 12.2 ppm, which is higher than the normal chemical shift for an ester of this type. The magnetic resonance data for Covid-19 pandemic, Covid-19, and 3D-19 are all constant with Covid-19 pandemic being the most intense. Covid-19 pandemic has a structural formula of C8H16O4N2S, which is different from Covid-19 and 3D-19, which have structural formulas of C8H14O4N2S. The three compounds have similar chemical shifts with covid-19 having a slightly higher frequency than covid-19 pandemic
Formula:C9H20NO5PPurity:Min. 95%Molecular weight:253.23 g/mol




