CymitQuimica logo

CAS 852388-72-8

:

5-(3-Chlorophenyl)-2-(1-piperidinyl)thiazolo[4,5-b]pyridine-7-carboxylic acid

Description:
5-(3-Chlorophenyl)-2-(1-piperidinyl)thiazolo[4,5-b]pyridine-7-carboxylic acid is a chemical compound characterized by its complex structure, which includes a thiazolo[4,5-b]pyridine core, a carboxylic acid functional group, and a piperidine moiety. The presence of the 3-chlorophenyl group contributes to its potential biological activity, as halogenated aromatic compounds often exhibit unique pharmacological properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. The carboxylic acid group can participate in hydrogen bonding and may influence the compound's acidity and reactivity. Overall, this compound's unique structural features and functional groups position it as a candidate for further research in therapeutic applications, particularly in areas related to neuropharmacology or oncology.
Formula:C18H16ClN3O2S
InChI:InChI=1S/C18H16ClN3O2S/c19-12-6-4-5-11(9-12)14-10-13(17(23)24)15-16(20-14)21-18(25-15)22-7-2-1-3-8-22/h4-6,9-10H,1-3,7-8H2,(H,23,24)
InChI key:InChIKey=NQUARGOVHABFHH-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(=NC(=C1)C3=CC(Cl)=CC=C3)N=C(S2)N4CCCCC4
Synonyms:
  • 5-(3-Chlorophenyl)-2-(1-piperidinyl)thiazolo[4,5-b]pyridine-7-carboxylic acid
  • Thiazolo[4,5-b]pyridine-7-carboxylic acid, 5-(3-chlorophenyl)-2-(1-piperidinyl)-
Found 2 products.