CymitQuimica logo

CAS 853267-91-1

:

Hythiemoside A

Description:
Hythiemoside A, with the CAS number 853267-91-1, is a naturally occurring compound that belongs to the class of flavonoids, specifically a type of glycoside. It is primarily derived from certain plant species, particularly those in traditional medicinal contexts. This compound is characterized by its complex structure, which typically includes a flavonoid backbone with sugar moieties attached, contributing to its solubility and bioactivity. Hythiemoside A has garnered interest in pharmacological research due to its potential antioxidant, anti-inflammatory, and anticancer properties. Studies suggest that it may interact with various biological pathways, influencing cellular processes and exhibiting protective effects against oxidative stress. Additionally, its safety profile and efficacy in therapeutic applications are subjects of ongoing research. As with many natural products, the specific characteristics, such as solubility, stability, and reactivity, can vary based on environmental conditions and the presence of other compounds. Overall, Hythiemoside A represents a promising area of study within natural product chemistry and pharmacology.
Formula:C28H46O9
InChI:InChI=1S/C28H46O9/c1-15(30)35-14-20(31)27(4)10-8-17-16(12-27)6-7-19-26(2,3)21(9-11-28(17,19)5)37-25-24(34)23(33)22(32)18(13-29)36-25/h12,17-25,29,31-34H,6-11,13-14H2,1-5H3/t17-,18-,19-,20+,21-,22-,23+,24-,25+,27+,28+/m1/s1
InChI key:ITRHSIFUIWDEGO-CHUAXZJFSA-N
SMILES:CC(=O)OC[C@@H]([C@]1(CC[C@@H]2C(=C1)CC[C@H]3[C@]2(CC[C@H](C3(C)C)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)C)C)O
Synonyms:
  • β-D-Glucopyranoside, (2R,4aS,4bR,7S,10aS)-7-[(1R)-2-(acetyloxy)-1-hydroxyethyl]-1,2,3,4,4a,4b,5,6,7,9,10,10a-dodecahydro-1,1,4a,7-tetramethyl-2-phenanthrenyl
  • (3α,5β,9β,10α,13α,15R)-3-(β-D-Glucopyranosyloxy)-15-hydroxypimar-8(14)-en-16-yl acetate
  • Hythiemoside A
Found 5 products.