CAS 853929-59-6

[2-(4-{[(2E)-3-(4-bromophenyl)prop-2-enoyl]amino}-3-fluorophenyl)-1,3-benzoxazol-5-yl]acetic acid

Description:

The chemical substance known as [2-(4-{[(2E)-3-(4-bromophenyl)prop-2-enoyl]amino}-3-fluorophenyl)-1,3-benzoxazol-5-yl]acetic acid, with the CAS number 853929-59-6, is a complex organic compound characterized by its multi-functional structure. It features a benzoxazole moiety, which contributes to its potential biological activity, and an acetic acid group that may enhance its solubility and reactivity. The presence of a bromophenyl group and a fluorophenyl group suggests that the compound may exhibit interesting electronic properties and could be involved in various interactions, making it a candidate for pharmaceutical applications. The compound's structure indicates potential for use in medicinal chemistry, particularly in the development of targeted therapies due to its ability to interact with biological targets. Additionally, the presence of multiple functional groups may allow for further modifications, enhancing its efficacy and specificity. Overall, this compound exemplifies the complexity and versatility often found in synthetic organic chemistry, particularly in the context of drug design and development.

Formula: C₂₄H₁₆BrFN₂O₄

InChI: InChI=1/C24H16BrFN2O4/c25-17-6-1-14(2-7-17)4-10-22(29)27-19-8-5-16(13-18(19)26)24-28-20-11-15(12-23(30)31)3-9-21(20)32-24/h1-11,13H,12H2,(H,27,29)(H,30,31)/b10-4+

InChI key: LKBXWNYXDMSFQU-ONNFQVAWSA-N

SMILES: C1=CC(=CC=C1/C=C/C(=O)NC2=C(C=C(C=C2)C3=NC4=C(O3)C=CC(=C4)CC(=O)O)F)Br

OGT 2115

CAS: 853929-59-6

OGT 2115

Formula: C₂₄H₁₆BrFN₂O₄

Purity: ≥95%

Molecular weight: 495.3

Ref: 54-BUP05417

OGT 2115

CAS: 853929-59-6

Formula: C₂₄H₁₆BrFN₂O₄

Purity: 97%

Molecular weight: 495.2972

Ref: IN-DA008FC4

OGT 2115

CAS: 853929-59-6

2-(2-(4-(3-(4-Bromophenyl)acrylamido)-3-fluorophenyl)benzo[d]oxazol-5-yl)acetic acid

Formula: C₂₄H₁₆BrFN₂O₄

Purity: 95%

Molecular weight: 495.3

Ref: IN-DG02654518

OGT 2115

Controlled Product

CAS: 853929-59-6

Formula: C₂₄H₁₆BrFN₂O₄

Color and Shape: Neat

Molecular weight: 495.297

Ref: TR-O410003

OGT 2115

CAS: 853929-59-6

OGT 2115 blocks heparanase (IC50=0.4µM), cleaving heparan sulfate; antiangiogenic (IC50=1µM).

Formula: C₂₄H₁₆BrFN₂O₄

Purity: 97.27%

Color and Shape: Solid

Molecular weight: 495.3

Ref: TM-T16380

2-[4-[[3-(4-Bromophenyl)-1-oxo-2-propenyl]amino]-3-fluorophenyl]-5-benzoxazoleacetic acid

CAS: 853929-59-6

Please enquire for more information about 2-[4-[[3-(4-Bromophenyl)-1-oxo-2-propenyl]amino]-3-fluorophenyl]-5-benzoxazoleacetic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₂₄H₁₆BrFN₂O₄

Purity: Min. 95%

Molecular weight: 495.3 g/mol

Ref: 3D-FB145584