CymitQuimica logo

CAS 85418-82-2

:

ethyl 6-methyl-4-oxo-1,4-dihydroquinoline-3-carboxylate

Description:
Ethyl 6-methyl-4-oxo-1,4-dihydroquinoline-3-carboxylate, with the CAS number 85418-82-2, is a chemical compound that belongs to the class of quinoline derivatives. This substance typically exhibits a yellow to orange crystalline appearance and is characterized by its complex bicyclic structure, which includes a quinoline ring system. The presence of the ethyl ester functional group contributes to its solubility in organic solvents, while the carboxylate moiety can participate in various chemical reactions, including esterification and amidation. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its properties, such as melting point, boiling point, and reactivity, can vary based on the specific conditions and purity of the sample. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks if ingested or inhaled. Overall, ethyl 6-methyl-4-oxo-1,4-dihydroquinoline-3-carboxylate is a notable compound for its potential applications in various fields of chemistry and pharmacology.
Formula:C13H13NO3
InChI:InChI=1/C13H13NO3/c1-3-17-13(16)10-7-14-11-5-4-8(2)6-9(11)12(10)15/h4-7H,3H2,1-2H3,(H,14,15)
InChI key:WRHXUGRUTJJRQQ-UHFFFAOYSA-N
SMILES:CCOC(=O)c1c[nH]c2ccc(C)cc2c1=O
Synonyms:
  • 3-Quinolinecarboxylic Acid, 1,4-Dihydro-6-Methyl-4-Oxo-, Ethyl Ester
  • 3-Quinolinecarboxylic Acid, 4-Hydroxy-6-Methyl-, Ethyl Ester
  • Ethyl 4-hydroxy-6-methylquinoline-3-carboxylate
  • Ethyl 6-methyl-4-oxo-1,4-dihydroquinoline-3-carboxylate
Found 4 products.