CymitQuimica logo

CAS 854828-86-7

:

1-benzyl-1,4-diazepan-5-one(HCl)

Description:
1-Benzyl-1,4-diazepan-5-one (HCl) is a chemical compound characterized by its diazepan structure, which consists of a seven-membered ring containing two nitrogen atoms. The presence of a benzyl group enhances its lipophilicity, potentially influencing its pharmacological properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. The compound may exhibit biological activity, possibly acting on the central nervous system due to its diazepan framework, which is commonly associated with anxiolytic and sedative effects. Its molecular structure allows for various interactions with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Further studies would be necessary to fully elucidate its pharmacodynamics, pharmacokinetics, and potential therapeutic applications.
Formula:C12H17ClN2O
InChI:InChI=1S/C12H16N2O.ClH/c15-12-6-8-14(9-7-13-12)10-11-4-2-1-3-5-11;/h1-5H,6-10H2,(H,13,15);1H
InChI key:FZPYTGOYFUEVSZ-UHFFFAOYSA-N
SMILES:C1CN(CCNC1=O)CC2=CC=CC=C2.Cl
Found 4 products.