CAS 85532-40-7
:ethyl 3-amino-3-methylbutanoate hydrochloride
Description:
Ethyl 3-amino-3-methylbutanoate hydrochloride is an organic compound characterized by its amine and ester functional groups. It is a hydrochloride salt, which enhances its solubility in water compared to its free base form. The compound features a branched-chain structure, with a methyl group attached to the carbon adjacent to the amino group, contributing to its steric properties. Ethyl 3-amino-3-methylbutanoate hydrochloride is typically a white to off-white crystalline powder, and it is hygroscopic, meaning it can absorb moisture from the air. This compound is often used in pharmaceutical applications, particularly in the synthesis of various bioactive molecules. Its properties, such as melting point, solubility, and stability, can vary based on environmental conditions and the presence of other substances. Safety data should be consulted for handling and storage, as with any chemical, to ensure proper precautions are taken. Overall, this compound is of interest in both research and industrial contexts due to its potential applications in medicinal chemistry.
Formula:C7H16ClNO2
InChI:InChI=1/C7H15NO2.ClH/c1-4-10-6(9)5-7(2,3)8;/h4-5,8H2,1-3H3;1H
SMILES:CCOC(=O)CC(C)(C)N.Cl
Synonyms:- Ethyl 3-amino-3-methylbutanoate hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ethyl 3-amino-3-methylbutanoate hydrochloride
CAS:Formula:C7H16ClNO2Purity:97%Color and Shape:SolidMolecular weight:181.6604Ref: IN-DA008HKE
50gTo inquire250gTo inquire500gTo inquire250mg20.00€1g23.00€5g28.00€10g46.00€25g70.00€100g202.00€Ethyl 3-Amino-3-methylbutyrate Hydrochloride
CAS:Formula:C7H15NO2·HClPurity:>98.0%(N)Color and Shape:White to Almost white powder to crystalMolecular weight:181.66Ethyl 3-amino-3-methylbutanoate hydrochloride
CAS:Ethyl 3-amino-3-methylbutanoate hydrochlorideFormula:C7H15NO2·ClHPurity:95%Color and Shape:SolidMolecular weight:181.66044Ethyl 3-amino-3-methylbutanoate hydrochloride
CAS:Ethyl 3-amino-3-methylbutanoate hydrochlorideFormula:C7H16ClNO2Purity:95%Molecular weight:181.66Ethyl 3-amino-3-methylbutanoate hydrochloride
CAS:Formula:C7H16ClNO2Purity:95.0%Color and Shape:SolidMolecular weight:181.66




