CymitQuimica logo

CAS 855738-89-5

:

9H-Carbazole, 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-

Description:
9H-Carbazole, 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- is an organic compound characterized by its unique structure, which combines the carbazole moiety with a boron-containing dioxaborolane group. The presence of the carbazole structure imparts notable properties such as fluorescence and potential applications in organic electronics, particularly in light-emitting diodes and photovoltaic devices. The dioxaborolane group enhances the compound's reactivity and solubility, making it suitable for various synthetic applications, including cross-coupling reactions in organic synthesis. This compound is typically stable under ambient conditions but may require careful handling due to the presence of boron, which can be reactive under certain conditions. Its molecular structure allows for potential modifications, making it a versatile building block in the development of advanced materials. Overall, this compound exemplifies the intersection of organic chemistry and materials science, showcasing the importance of functional groups in determining the properties and applications of chemical substances.
Formula:C18H20BNO2
InChI:InChI=1S/C18H20BNO2/c1-17(2)18(3,4)22-19(21-17)12-9-10-16-14(11-12)13-7-5-6-8-15(13)20-16/h5-11,20H,1-4H3
InChI key:ARVCVPGNHWNNAF-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)NC4=CC=CC=C43
Synonyms:
  • 3-(4,4,5,5-Tetramethyl-1,3,2-Dioxaborolan-2-Yl)-Carbazole
  • 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-Carbazole
  • 9H-Carbazole-3-boronic acid pinacol ester
Found 5 products.