CymitQuimica logo

CAS 856437-22-4

:

1-[2-(dimethylamino)ethyl]-5-oxopyrrolidine-3-carboxylic acid

Description:
1-[2-(Dimethylamino)ethyl]-5-oxopyrrolidine-3-carboxylic acid, with the CAS number 856437-22-4, is a chemical compound characterized by its unique structural features, including a pyrrolidine ring and a carboxylic acid functional group. This compound typically exhibits properties associated with both basic and acidic functionalities due to the presence of the dimethylamino group and the carboxylic acid, which can influence its solubility and reactivity in various solvents. It is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The presence of the dimethylamino group may enhance its lipophilicity, potentially affecting its pharmacokinetic properties. Additionally, the oxopyrrolidine structure may contribute to its stability and reactivity in chemical reactions. Overall, this compound represents a class of molecules that can be valuable in drug design and development, although specific applications would depend on further research and characterization.
Formula:C9H16N2O3
InChI:InChI=1/C9H16N2O3/c1-10(2)3-4-11-6-7(9(13)14)5-8(11)12/h7H,3-6H2,1-2H3,(H,13,14)
SMILES:CN(C)CCN1CC(CC1=O)C(=O)O
Synonyms:
  • 3-Pyrrolidinecarboxylic Acid, 1-[2-(Dimethylamino)Ethyl]-5-Oxo-
Found 1 products.