CAS 85650-56-2

Asenapine maleate

Description:

Asenapine maleate is an atypical antipsychotic medication primarily used in the treatment of schizophrenia and bipolar disorder. It is a salt form of asenapine, which is a dibenzo-oxepine derivative. The compound exhibits a complex structure that allows it to interact with various neurotransmitter receptors in the brain, particularly serotonin and dopamine receptors, which are crucial in mood regulation and psychotic disorders. Asenapine maleate is typically administered sublingually, allowing for rapid absorption and onset of action. Its pharmacological profile includes antagonistic activity at multiple receptor sites, contributing to its efficacy in managing symptoms of psychosis and mood stabilization. The substance is characterized by its low solubility in water, which influences its formulation and delivery methods. Common side effects may include sedation, weight gain, and metabolic changes, necessitating careful monitoring during treatment. Overall, asenapine maleate represents a significant option in psychiatric pharmacotherapy, with a unique mechanism of action and a specific therapeutic application.

Formula:C₁₇H₁₆ClNO·C₄H₄O₄

InChI:InChI=1/C17H16ClNO.C4H4O4/c1-19-9-14-12-4-2-3-5-16(12)20-17-7-6-11(18)8-13(17)15(14)10-19;5-3(6)1-2-4(7)8/h2-8,14-15H,9-10H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/t14-,15-;/s2

InChI key:InChIKey=GMDCDXMAFMEDAG-UHGYJBHVNA-N

SMILES:CN1C[C@]2([C@@](C=3C(OC=4C2=CC(Cl)=CC4)=CC=CC3)(C1)[H])[H].C(=C\C(O)=O)\C(O)=O

Synonyms:

(3aR,12bR)-5-chloro-2-methyl-2,3,3a,12b-tetrahydro-1H-dibenzo[2,3:6,7]oxepino[4,5-c]pyrrole (2Z)-but-2-enedioate
(3aS,12bS)-5-chloro-2-methyl-2,3,3a,12b-tetrahydro-1H-dibenzo[2,3:6,7]oxepino[4,5-c]pyrrole (2Z)-but-2-enedioate
1H-Dibenz[2,3:6,7]oxepino[4,5-c]pyrrole, 5-chloro-2,3,3a,12b-tetrahydro-2-methyl-, (3aR,12bR)-rel-, (2Z)-2-butenedioate (1:1)
1H-Dibenz[2,3:6,7]oxepino[4,5-c]pyrrole, 5-chloro-2,3,3a,12b-tetrahydro-2-methyl-, trans-, (Z)-2-butenedioate (1:1)
Asenapine Maleate
Org 5222