CymitQuimica logo

CAS 857177-01-6

:

ethyl 2-oxo-2-(4-oxotetrahydro-2H-pyran-3-yl)acetate

Description:
Ethyl 2-oxo-2-(4-oxotetrahydro-2H-pyran-3-yl)acetate, identified by its CAS number 857177-01-6, is an organic compound characterized by its complex structure, which includes an ethyl ester functional group and a tetrahydropyran ring. This compound features a ketone group, contributing to its reactivity and potential applications in organic synthesis. The presence of the tetrahydropyran moiety suggests that it may exhibit interesting stereochemical properties and could participate in various chemical reactions, such as nucleophilic additions or cycloadditions. Ethyl 2-oxo-2-(4-oxotetrahydro-2H-pyran-3-yl)acetate may be of interest in medicinal chemistry and materials science due to its potential biological activity and utility as an intermediate in the synthesis of more complex molecules. Its solubility, stability, and reactivity would depend on the specific conditions of use, including solvent choice and temperature. Overall, this compound represents a versatile building block in organic chemistry with potential applications in various fields.
Formula:C9H12O5
InChI:InChI=1S/C9H12O5/c1-2-14-9(12)8(11)6-5-13-4-3-7(6)10/h6H,2-5H2,1H3
InChI key:QMOCKDHJHSQMJF-UHFFFAOYSA-N
SMILES:CCOC(=O)C(=O)C1COCCC1=O
Found 3 products.