CymitQuimica logo

CAS 857283-58-0

:

N,2-Dimethylimidazo[1,2-a]pyridine-3-methanamine

Description:
N,2-Dimethylimidazo[1,2-a]pyridine-3-methanamine is a chemical compound characterized by its imidazo-pyridine structure, which includes a fused ring system containing nitrogen atoms. This compound features two methyl groups at the nitrogen positions (N and 2) and a methanamine group at the 3-position of the imidazo ring. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amine functional group. The compound is of interest in various fields, including medicinal chemistry and toxicology, as it may be involved in biological processes or serve as a precursor in synthetic pathways. Its molecular structure suggests potential reactivity, particularly in nucleophilic substitution reactions due to the presence of the amine group. Additionally, the presence of multiple nitrogen atoms may influence its electronic properties, making it a candidate for studies related to pharmacological activity or environmental impact. Safety data and handling precautions should be considered, as with any chemical substance, particularly those with potential biological activity.
Formula:C10H13N3
InChI:InChI=1S/C10H13N3/c1-8-9(7-11-2)13-6-4-3-5-10(13)12-8/h3-6,11H,7H2,1-2H3
InChI key:InChIKey=RDOSBGVNNQNNAV-UHFFFAOYSA-N
SMILES:C(NC)C=1N2C(=NC1C)C=CC=C2
Synonyms:
  • N,2-Dimethylimidazo[1,2-a]pyridine-3-methanamine
  • Imidazo[1,2-a]pyridine-3-methanamine, N,2-dimethyl-
Found 1 products.